EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30O9 |
| Net Charge | 0 |
| Average Mass | 462.495 |
| Monoisotopic Mass | 462.18898 |
| SMILES | COc1cc(C(=O)O[C@@H](c2cc(OC)c(OC)c(OC)c2)[C@H](C)C(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C24H30O9/c1-13(14(2)25)21(15-9-17(27-3)22(31-7)18(10-15)28-4)33-24(26)16-11-19(29-5)23(32-8)20(12-16)30-6/h9-13,21H,1-8H3/t13-,21-/m1/s1 |
| InChIKey | IGPMFSHAEMUEMC-LRTDBIEQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beilschmiedia tsangii (IPNI:462970-1) | root (BTO:0001188) | PubMed (21846089) | Cold MeOH extract of dry and sliced roots |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tsangin C (CHEBI:69320) has role metabolite (CHEBI:25212) |
| tsangin C (CHEBI:69320) is a trihydroxybenzoic acid (CHEBI:27115) |
| Synonym | Source |
|---|---|
| [(1R,2S)-2-methyl-3-oxo-1-(3,4,5-trimethoxyphenyl)butyl]3,4,5-trimethoxybenzoate | ChEBI |
| Citations |
|---|