EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O7 |
| Net Charge | 0 |
| Average Mass | 402.443 |
| Monoisotopic Mass | 402.16785 |
| SMILES | COc1cc([C@@H]2O[C@@H](c3cc(OC)c4c(c3)OCO4)[C@H](C)[C@H]2C)cc(O)c1OC |
| InChI | InChI=1S/C22H26O7/c1-11-12(2)20(14-8-17(25-4)22-18(9-14)27-10-28-22)29-19(11)13-6-15(23)21(26-5)16(7-13)24-3/h6-9,11-12,19-20,23H,10H2,1-5H3/t11-,12-,19-,20-/m1/s1 |
| InChIKey | VDZKDMJORWVROZ-IIBDXVJDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beilschmiedia tsangii (IPNI:462970-1) | root (BTO:0001188) | PubMed (21846089) | Cold MeOH extract of dry and sliced roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| beilschminol A, rel- (CHEBI:69319) has role metabolite (CHEBI:25212) |
| beilschminol A, rel- (CHEBI:69319) is a lignan (CHEBI:25036) |
| Synonyms | Source |
|---|---|
| rel-2,3-dimethoxy-5-((2R,3R,4R,5R)-5-(7-methoxybenzo[d][1,3]dioxol-5-yl)-3,4-dimethyltetrahydrofuran-2-yl)phenol | ChEBI |
| rel-(7R,8R,7'R,8'R)-3-hydroxy-3',4'-methylenedioxy-4,5,5'-trimethoxy-7,7'-epoxylignan | ChEBI |
| Citations |
|---|