EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H33NO3 |
| Net Charge | 0 |
| Average Mass | 407.554 |
| Monoisotopic Mass | 407.24604 |
| SMILES | [H][C@@]12C=C[C@]3([H])[C@H](C(=O)NCC(C)C)[C@@]1([H])C[C@@]1([H])[C@H](CCCc4ccc5c(c4)OCO5)[C@]3([H])[C@@]21[H] |
| InChI | InChI=1S/C26H33NO3/c1-14(2)12-27-26(28)25-18-8-7-17-20(25)11-19-16(23(18)24(17)19)5-3-4-15-6-9-21-22(10-15)30-13-29-21/h6-10,14,16-20,23-25H,3-5,11-13H2,1-2H3,(H,27,28)/t16-,17+,18-,19-,20-,23-,24-,25-/m0/s1 |
| InChIKey | MZNYKIXDEPFZJF-VOMQUASUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beilschmiedia tsangii (IPNI:462970-1) | root (BTO:0001188) | PubMed (21846089) | Cold MeOH extract of dry and sliced roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| endiandramide B, rel- (CHEBI:69318) has role metabolite (CHEBI:25212) |
| endiandramide B, rel- (CHEBI:69318) is a benzodioxoles (CHEBI:38298) |
| Synonym | Source |
|---|---|
| rel-(1R,2R,3R,4S,5S,7S,8R,9S)-4-[3-(1,3-Benzodioxol-5-yl)propyl]-N-isobutyltetracyclo[5.4.0.02,5.03,9]undec-10-ene-8-carboxamide | ChEBI |
| Citations |
|---|