EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30O4 |
| Net Charge | 0 |
| Average Mass | 406.522 |
| Monoisotopic Mass | 406.21441 |
| SMILES | [H][C@@]12C=C[C@@]3([H])[C@H](/C=C/C(=O)O)[C@]1([H])C[C@@]1([H])[C@H](CCCCCc4ccc5c(c4)OCO5)[C@@]3([H])[C@@]21[H] |
| InChI | InChI=1S/C26H30O4/c27-24(28)11-9-16-18-7-8-19-20(16)13-21-17(25(18)26(19)21)5-3-1-2-4-15-6-10-22-23(12-15)30-14-29-22/h6-12,16-21,25-26H,1-5,13-14H2,(H,27,28)/b11-9+/t16-,17-,18-,19+,20-,21-,25+,26-/m0/s1 |
| InChIKey | JEVKBOABRNPNLG-VLZOBNMESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beilschmiedia tsangii (IPNI:462970-1) | root (BTO:0001188) | PubMed (21846089) | Cold MeOH extract of dry and sliced roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| endiandric acid L, rel- (CHEBI:69317) has role metabolite (CHEBI:25212) |
| endiandric acid L, rel- (CHEBI:69317) is a benzodioxoles (CHEBI:38298) |
| Synonym | Source |
|---|---|
| rel-3-{(1R,2R,3S,4S,5S,7R,8R,9S)-4-[5-(1,3-Benzodioxol-5-yl)pentyl]tetracyclo[5.4.0.0(2,5).0(3,9)]undec-10-en-8-yl}acrylic acid | ChEBI |
| Citations |
|---|