EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H24O4 |
| Net Charge | 0 |
| Average Mass | 352.430 |
| Monoisotopic Mass | 352.16746 |
| SMILES | [H][C@@]12C=C[C@]3([H])[C@H](C(=O)O)[C@@]1([H])C[C@@]1([H])[C@H](CCCc4ccc5c(c4)OCO5)[C@]3([H])[C@@]21[H] |
| InChI | InChI=1S/C22H24O4/c23-22(24)21-14-6-5-13-16(21)9-15-12(19(14)20(13)15)3-1-2-11-4-7-17-18(8-11)26-10-25-17/h4-8,12-16,19-21H,1-3,9-10H2,(H,23,24)/t12-,13+,14-,15-,16-,19-,20-,21-/m0/s1 |
| InChIKey | SMOQNODVPACIFX-CZWRZWPQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beilschmiedia tsangii (IPNI:462970-1) | root (BTO:0001188) | PubMed (21846089) | Cold MeOH extract of dry and sliced roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| endiandric acid K, rel- (CHEBI:69316) has role metabolite (CHEBI:25212) |
| endiandric acid K, rel- (CHEBI:69316) is a benzodioxoles (CHEBI:38298) |
| Synonym | Source |
|---|---|
| rel-(1R,2R,3R,4S,5S,7S,8R,9S)-4-[3-(1,3-Benzodioxol-5-yl)propyl]tetracyclo[5.4.0.0(2,5).0(3,9)]undec-10-ene-8-carboxylic acid | ChEBI |
| Citations |
|---|