EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H31NO3 |
| Net Charge | 0 |
| Average Mass | 405.538 |
| Monoisotopic Mass | 405.23039 |
| SMILES | [H][C@@]12[C@@]3([H])[C@@]4([H])C[C@@]1([H])C=C[C@@H](C(=O)NCC(C)C)[C@]2([H])C=C[C@]3([H])[C@H]4Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H31NO3/c1-14(2)12-27-26(28)19-5-4-16-11-21-20(18-7-6-17(19)24(16)25(18)21)9-15-3-8-22-23(10-15)30-13-29-22/h3-8,10,14,16-21,24-25H,9,11-13H2,1-2H3,(H,27,28)/t16-,17+,18-,19-,20-,21+,24-,25-/m1/s1 |
| InChIKey | VJYDYOYYSFAXSI-DLGBIPEUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beilschmiedia tsangii (IPNI:462970-1) | root (BTO:0001188) | PubMed (21846089) | Cold MeOH extract of dry and sliced roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| endiandramide A (CHEBI:69315) has role metabolite (CHEBI:25212) |
| endiandramide A (CHEBI:69315) is a benzodioxoles (CHEBI:38298) |
| Synonym | Source |
|---|---|
| (1S,1aS,2aS,5R,5aR,7aR,7bS,7cS)-1-(1,3-Benzodioxol-5-ylmethyl)-N-isobutyl-1a,2,2a,5,5a,7a,7b,7c-octahydro-1H-cyclobuta[bc]acenaphthylene-5-carboxamide | ChEBI |
| Citations |
|---|