EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O4 |
| Net Charge | 0 |
| Average Mass | 350.414 |
| Monoisotopic Mass | 350.15181 |
| SMILES | [H][C@@]12[C@@]3([H])[C@@]4([H])C[C@@]1([H])C=C[C@@H](C(=O)O)[C@]2([H])C=C[C@]3([H])[C@H]4Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H22O4/c23-22(24)15-3-2-12-9-17-16(14-5-4-13(15)20(12)21(14)17)7-11-1-6-18-19(8-11)26-10-25-18/h1-6,8,12-17,20-21H,7,9-10H2,(H,23,24)/t12-,13+,14-,15-,16-,17+,20-,21-/m1/s1 |
| InChIKey | DXINWPCQBUXMER-STJBOKOVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beilschmiedia tsangii (IPNI:462970-1) | root (BTO:0001188) | PubMed (21846089) | Cold MeOH extract of dry and sliced roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tsangibeilin B, rel- (CHEBI:69314) has role metabolite (CHEBI:25212) |
| tsangibeilin B, rel- (CHEBI:69314) is a benzodioxoles (CHEBI:38298) |
| Synonym | Source |
|---|---|
| rel-(1S,1aS,2aS,5R,5aR,7aR,7bS,7cS)-1-(1,3-Benzodioxol-5-ylmethyl)-1a,2,2a,5,5a,7a,7b,7c-octahydro-1H-cyclobuta[bc]acenaphthylene-5-carboxylic acid | ChEBI |
| Citations |
|---|