EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26O4 |
| Net Charge | 0 |
| Average Mass | 378.468 |
| Monoisotopic Mass | 378.18311 |
| SMILES | [H][C@@]12[C@@]3([H])[C@@]4([H])C[C@@]1([H])C=C[C@@H](C(=O)O)[C@]2([H])C=C[C@]3([H])[C@H]4CCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H26O4/c25-24(26)18-6-5-14-11-19-15(16-7-8-17(18)22(14)23(16)19)3-1-2-13-4-9-20-21(10-13)28-12-27-20/h4-10,14-19,22-23H,1-3,11-12H2,(H,25,26)/t14-,15-,16-,17+,18-,19+,22-,23-/m1/s1 |
| InChIKey | SSXKICOQNGDABW-UILCEBSMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beilschmiedia tsangii (IPNI:462970-1) | root (BTO:0001188) | PubMed (21846089) | Cold MeOH extract of dry and sliced roots |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tsangibeilin A, rac- (CHEBI:69313) has role metabolite (CHEBI:25212) |
| tsangibeilin A, rac- (CHEBI:69313) is a benzodioxoles (CHEBI:38298) |
| Synonym | Source |
|---|---|
| rel-(1S,1aS,2aS,5R,5aR,7aR,7bS,7cS)-1-[3-(1,3-Benzodioxol-5-yl)propyl]-1a,2,2a,5,5a,7a,7b,7c-octahydro-1H-cyclobuta[bc]acenaphthylene-5-carboxylic acid | ChEBI |
| Citations |
|---|