EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O |
| Net Charge | 0 |
| Average Mass | 286.459 |
| Monoisotopic Mass | 286.22967 |
| SMILES | [H][C@@]1([C@@H](C)CCC=C(C)C)CC[C@@H](C)c2c(O)cc(C)cc21 |
| InChI | InChI=1S/C20H30O/c1-13(2)7-6-8-15(4)17-10-9-16(5)20-18(17)11-14(3)12-19(20)21/h7,11-12,15-17,21H,6,8-10H2,1-5H3/t15-,16+,17-/m0/s1 |
| InChIKey | WQVJUBFKFCDYDQ-BBWFWOEESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leucophyllum frutescens (ncbitaxon:86643) | root (BTO:0001188) | PubMed (21859082) | Previous component: root bark; MeOH extract of air-dried and pulverized root bark |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leubethanol (CHEBI:69308) has role metabolite (CHEBI:25212) |
| Leubethanol (CHEBI:69308) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| (5S,8R)-3,8-Dimethyl-5-[(2S)-6-methyl-5-hepten-2-yl]-5,6,7,8-tetrahydro-1-naphthalinol | ChEBI |
| Citations |
|---|