EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28O4 |
| Net Charge | 0 |
| Average Mass | 308.418 |
| Monoisotopic Mass | 308.19876 |
| SMILES | CCCCCCCC[C@]1(OC)O[C@@H](OC)c2c(O)cccc21 |
| InChI | InChI=1S/C18H28O4/c1-4-5-6-7-8-9-13-18(21-3)14-11-10-12-15(19)16(14)17(20-2)22-18/h10-12,17,19H,4-9,13H2,1-3H3/t17-,18+/m1/s1 |
| InChIKey | VKMFJAVAGSMZBP-MSOLQXFVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paecilomyces variotii (ncbitaxon:45996) | mycelium (BTO:0001436) | PubMed (21744790) | EtOAc extract of culture medium and mycelium,fungus isolated from inner tissue of Nemopilema nomurai |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Paecilocin C, (rel)- (CHEBI:69302) has role metabolite (CHEBI:25212) |
| Paecilocin C, (rel)- (CHEBI:69302) is a phenols (CHEBI:33853) |
| Synonym | Source |
|---|---|
| rel-(1S,3R)-1,3-dimethoxy-1-octyl-3H-2-benzofuran-4-ol | ChEBI |
| Citations |
|---|