EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H22O3 |
| Net Charge | 0 |
| Average Mass | 262.349 |
| Monoisotopic Mass | 262.15689 |
| SMILES | CCCCCCCC[C@@H]1OC(=O)c2c(O)cccc21 |
| InChI | InChI=1S/C16H22O3/c1-2-3-4-5-6-7-11-14-12-9-8-10-13(17)15(12)16(18)19-14/h8-10,14,17H,2-7,11H2,1H3/t14-/m0/s1 |
| InChIKey | SUNBNRKGEMWQKP-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paecilomyces variotii (ncbitaxon:45996) | mycelium (BTO:0001436) | PubMed (21744790) | EtOAc extract of culture medium and mycelium,fungus isolated from inner tissue of Nemopilema nomurai |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Paecilocin A (CHEBI:69300) has role metabolite (CHEBI:25212) |
| Paecilocin A (CHEBI:69300) is a isobenzofuranone (CHEBI:55372) |
| Synonyms | Source |
|---|---|
| (3S)-7-Hydroxy-3-octyl-2-benzofuran-1(3H)-one | ChEBI |
| (S)-7-hydroxy-3-octylphthalide | ChEBI |
| Citations |
|---|