EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12O3 |
| Net Charge | 0 |
| Average Mass | 216.236 |
| Monoisotopic Mass | 216.07864 |
| SMILES | CC(=O)/C=C/c1cccc2c1CCOC2=O |
| InChI | InChI=1S/C13H12O3/c1-9(14)5-6-10-3-2-4-12-11(10)7-8-16-13(12)15/h2-6H,7-8H2,1H3/b6-5+ |
| InChIKey | RINHRISDQZMBAU-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Swertia mileensis (ncbitaxon:266086) | whole plant (BTO:0001461) | PubMed (21823575) | 50% and 90% aqueous ethanol extracts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Swerilactone O (CHEBI:69299) has functional parent cinnamic acid (CHEBI:27386) |
| Swerilactone O (CHEBI:69299) has role metabolite (CHEBI:25212) |
| Swerilactone O (CHEBI:69299) is a olefinic compound (CHEBI:78840) |
| Synonym | Source |
|---|---|
| 5-[(E)-3-oxobut-1-enyl]-3,4-dihydroisochromen-1-one | ChEBI |
| Citations |
|---|