EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O5 |
| Net Charge | 0 |
| Average Mass | 238.239 |
| Monoisotopic Mass | 238.08412 |
| SMILES | CC(=O)C[C@@H]1O[C@@H](C)C(=O)C2=C1C(=O)OCC2 |
| InChI | InChI=1S/C12H14O5/c1-6(13)5-9-10-8(3-4-16-12(10)15)11(14)7(2)17-9/h7,9H,3-5H2,1-2H3/t7-,9-/m0/s1 |
| InChIKey | YUSMWIJHTGHEPG-CBAPKCEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Swertia mileensis (ncbitaxon:266086) | whole plant (BTO:0001461) | PubMed (21823575) | 50% and 90% aqueous ethanol extracts |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Swerilactone L, (rel)- (CHEBI:69296) has role metabolite (CHEBI:25212) |
| Swerilactone L, (rel)- (CHEBI:69296) is a pyranopyranone (CHEBI:131901) |
| Synonym | Source |
|---|---|
| rel-(1S,3S)-3-methyl-1-(2-oxopropyl)-5,6-dihydro-1H-pyrano[3,4-c]pyran-4,8-dione | ChEBI |
| Citations |
|---|