EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H28O4 |
| Net Charge | 0 |
| Average Mass | 380.484 |
| Monoisotopic Mass | 380.19876 |
| SMILES | COc1ccc(/C=C/C2CCC=CC2c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C24H28O4/c1-25-21-13-10-17(15-23(21)27-3)9-11-18-7-5-6-8-20(18)19-12-14-22(26-2)24(16-19)28-4/h6,8-16,18,20H,5,7H2,1-4H3/b11-9+ |
| InChIKey | PHLVYOUORNHOLU-PKNBQFBNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zingiber cassumunar (IPNI:798323-1) | rhizome (BTO:0001181) | PubMed (21770432) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(3,4-dimethoxyphenyl)-4-[(E)-3,4-dimethoxystyryl]cyclohex-1-ene (CHEBI:69295) has role metabolite (CHEBI:25212) |
| 3-(3,4-dimethoxyphenyl)-4-[(E)-3,4-dimethoxystyryl]cyclohex-1-ene (CHEBI:69295) is a methoxybenzenes (CHEBI:51683) |
| Synonym | Source |
|---|---|
| (±)-3-(3,4-dimethoxyphenyl)-4-[(E)-3,4-dimethoxystyryl]cyclohex-1-ene | ChEBI |
| Citations |
|---|