EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H34O15 |
| Net Charge | 0 |
| Average Mass | 706.653 |
| Monoisotopic Mass | 706.18977 |
| SMILES | C[C@@H]1Cc2c(c(O)c3c(=O)cc4oc5c(O)cc(O[C@@H]6O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)c6c(=O)c7c8c(c56)c4c3c2O[C@@]8(O)[C@@H](C)O[C@@H]7C)[C@@H](C)O1 |
| InChI | InChI=1S/C36H34O15/c1-9-5-13-19(10(2)46-9)29(41)21-14(38)6-16-22-24-26-23(30(42)20-11(3)47-12(4)36(45,27(20)24)51-33(13)25(21)22)17(7-15(39)34(26)48-16)49-35-32(44)31(43)28(40)18(8-37)50-35/h6-7,9-12,18,28,31-32,35,37,39-41,43-45H,5,8H2,1-4H3/t9-,10-,11-,12-,18-,28-,31+,32-,35-,36+/m1/s1 |
| InChIKey | HYHJXJZKQSIEPS-CZTBGZCOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Megoura crassicauda (ncbitaxon:469902) | - | PubMed (21830784) | The green aphids Megoura crassicauda, were collected from leaves of Vicia sativa |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| viridaphin A1 glucoside (CHEBI:69293) has role metabolite (CHEBI:25212) |
| viridaphin A1 glucoside (CHEBI:69293) is a benzochromenone (CHEBI:64986) |
| viridaphin A1 glucoside (CHEBI:69293) is a glycoside (CHEBI:24400) |
| Synonym | Source |
|---|---|
| (8R,10R,12aR,13R,15R)-3,7,12a-Trihydroxy-8,10,13,15-tetramethyl-6,16-dioxo-8,10,11,12a,15,16-hexahydro-6H,13H-4,9,12,14-tetraoxadibenzo[b,jk]cyclohepta[1,2,3,4,5,6-rstuv]pentahelicen-1-yl beta-D-gluco pyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 26611430 | ChemSpider |
| Citations |
|---|