EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H37O6S.Na |
| Net Charge | 0 |
| Average Mass | 488.622 |
| Monoisotopic Mass | 488.22085 |
| SMILES | [H][C@]12CC/C(=C\OS(=O)(=O)[O-])[C@H](CCC3=CC(=O)OC3)[C@@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C.[Na+] |
| InChI | InChI=1S/C25H38O6S.Na/c1-23(2)11-5-12-25(4)20(23)10-13-24(3)19(8-6-17-14-22(26)30-15-17)18(7-9-21(24)25)16-31-32(27,28)29;/h14,16,19-21H,5-13,15H2,1-4H3,(H,27,28,29);/q;+1/p-1/b18-16+;/t19-,20-,21-,24+,25-;/m0./s1 |
| InChIKey | NNXRQZJLAXDULG-NAVIIXIYSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coscinoderma (ncbitaxon:1162776) | - | PubMed (21827183) | Methanol and methylene dichloride extract of lyophilized and macerated sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium(E)-((1R,4aS,4bS,8aS,10aS)-4b,8,8,10a-tetramethyl-1-(2-(5-oxo-2,5-dihydrofuran-3-yl)ethyl)decahydrophenanthren-2(1H,3H,4bH)-ylidene)methyl sulfate (CHEBI:69287) has role metabolite (CHEBI:25212) |
| sodium(E)-((1R,4aS,4bS,8aS,10aS)-4b,8,8,10a-tetramethyl-1-(2-(5-oxo-2,5-dihydrofuran-3-yl)ethyl)decahydrophenanthren-2(1H,3H,4bH)-ylidene)methyl sulfate (CHEBI:69287) is a organic molecular entity (CHEBI:50860) |
| Citations |
|---|