EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H37O5S.Na |
| Net Charge | 0 |
| Average Mass | 472.623 |
| Monoisotopic Mass | 472.22594 |
| SMILES | [H][C@]12CC/C(=C\OS(=O)(=O)[O-])[C@H](CCc3ccoc3)[C@@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C.[Na+] |
| InChI | InChI=1S/C25H38O5S.Na/c1-23(2)12-5-13-25(4)21(23)10-14-24(3)20(8-6-18-11-15-29-16-18)19(7-9-22(24)25)17-30-31(26,27)28;/h11,15-17,20-22H,5-10,12-14H2,1-4H3,(H,26,27,28);/q;+1/p-1/b19-17+;/t20-,21-,22-,24+,25-;/m0./s1 |
| InChIKey | LCLILMARVYROOR-VNINRLMRSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coscinoderma (ncbitaxon:1162776) | - | PubMed (21827183) | Methanol and methylene dichloride extract of lyophilized and macerated sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| suvanine's sodium salt (CHEBI:69285) has role metabolite (CHEBI:25212) |
| suvanine's sodium salt (CHEBI:69285) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| Sodium (E)-[(8alpha,13E,14alpha)-14-{2-[(2S)-2-hydroxy-5-oxo-2,5-dihydro-3-furanyl]ethyl}-8-methylpodocarpan-13-ylidene]methyl sulfate | ChEBI |
| Citations |
|---|