EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H37O5S.C3H9N3 |
| Net Charge | -1 |
| Average Mass | 536.759 |
| Monoisotopic Mass | 536.31637 |
| SMILES | CN(C)C(=N)N.[H][C@]12CC/C(=C\OS(=O)(=O)[O-])[C@H](CCc3ccoc3)[C@@]1(C)CC[C@@]1([H])C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C25H38O5S.C3H9N3/c1-23(2)12-5-13-25(4)21(23)10-14-24(3)20(8-6-18-11-15-29-16-18)19(7-9-22(24)25)17-30-31(26,27)28;1-6(2)3(4)5/h11,15-17,20-22H,5-10,12-14H2,1-4H3,(H,26,27,28);1-2H3,(H3,4,5)/p-1/b19-17+;/t20-,21-,22-,24+,25-;/m0./s1 |
| InChIKey | MUGYGAQKMRBEQJ-VNINRLMRSA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coscinoderma (ncbitaxon:1162776) | - | PubMed (21827183) | Methanol and methylene dichloride extract of lyophilized and macerated sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Suvanine (CHEBI:69284) has role metabolite (CHEBI:25212) |
| Suvanine (CHEBI:69284) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| (E)-{(8alpha,13E,14alpha)-14-[2-(3-Furyl)ethyl]-8-methylpodocarpan-13-ylidene}methyl hydrogen sulfate - 1,1-dimethylguanidine (1:1) | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:94203-53-9 | ChemIDplus |
| Citations |
|---|