EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H47O6S.Na |
| Net Charge | 0 |
| Average Mass | 570.768 |
| Monoisotopic Mass | 570.29910 |
| SMILES | [H][C@@]12CC=C(C)[C@H](C[C@@H](OS(=O)(=O)[O-])[C@H](C)CCC/C(C)=C\Cc3cc(O)ccc3O)[C@@]1(C)CCCC2(C)C.[Na+] |
| InChI | InChI=1S/C31H48O6S.Na/c1-21(11-13-24-19-25(32)14-15-27(24)33)9-7-10-23(3)28(37-38(34,35)36)20-26-22(2)12-16-29-30(4,5)17-8-18-31(26,29)6;/h11-12,14-15,19,23,26,28-29,32-33H,7-10,13,16-18,20H2,1-6H3,(H,34,35,36);/q;+1/p-1/b21-11-;/t23-,26+,28-,29+,31-;/m1./s1 |
| InChIKey | MWESFEYZPAHLCJ-YKCGTWPASA-M |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coscinoderma (ncbitaxon:1162776) | - | PubMed (21827183) | Methanol and methylene dichloride extract of lyophilized and macerated sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium(2R,3R,Z)-9-(2,5-dihydroxyphenyl)-3,7-dimethyl-1-((1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)non-7-en-2-yl sulfate (CHEBI:69282) has role metabolite (CHEBI:25212) |
| sodium(2R,3R,Z)-9-(2,5-dihydroxyphenyl)-3,7-dimethyl-1-((1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)non-7-en-2-yl sulfate (CHEBI:69282) is a organic molecular entity (CHEBI:50860) |
| Citations |
|---|