EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H46O2 |
| Net Charge | 0 |
| Average Mass | 450.707 |
| Monoisotopic Mass | 450.34978 |
| SMILES | [H][C@@]12CC=C(C)[C@H](C/C=C(\C)CCC/C(C)=C/Cc3cc(O)ccc3O)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C31H46O2/c1-22(11-14-25-21-26(32)15-17-28(25)33)9-7-10-23(2)12-16-27-24(3)13-18-29-30(4,5)19-8-20-31(27,29)6/h11-13,15,17,21,27,29,32-33H,7-10,14,16,18-20H2,1-6H3/b22-11+,23-12+/t27-,29-,31+/m0/s1 |
| InChIKey | FBBXOWQBMFRXRO-PGGDNBTOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Coscinoderma (ncbitaxon:1162776) | - | PubMed (21827183) | Methanol and methylene dichloride extract of lyophilized and macerated sponge |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-((2E,7E)-3,7-dimethyl-9-((1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)nona-2,7-dienyl)benzene-1,4-diol (CHEBI:69279) has role metabolite (CHEBI:25212) |
| 2-((2E,7E)-3,7-dimethyl-9-((1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)nona-2,7-dienyl)benzene-1,4-diol (CHEBI:69279) is a sesterterpenoid (CHEBI:26660) |
| Citations |
|---|