EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40O6 |
| Net Charge | 0 |
| Average Mass | 484.633 |
| Monoisotopic Mass | 484.28249 |
| SMILES | [H][C@]12C[C@]3([H])CC[C@]4([H])[C@](C)(CC[C@@]5([H])O[C@@H](c6ccc(O)cc6)OC[C@@]45C)[C@@]3(CC[C@]1(O)COC(C)=O)C2 |
| InChI | InChI=1S/C29H40O6/c1-18(30)33-17-29(32)13-12-28-15-21(29)14-20(28)6-9-23-26(2)16-34-25(19-4-7-22(31)8-5-19)35-24(26)10-11-27(23,28)3/h4-5,7-8,20-21,23-25,31-32H,6,9-17H2,1-3H3/t20-,21+,23-,24+,25-,26-,27-,28-,29-/m0/s1 |
| InChIKey | JQSXTZPTXNNYCX-IXVQIIOTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tolypocladium inflatum (ncbitaxon:29910) | - | PubMed (21812410) | Ethylacetate extract and fungus isolated from a soilsample on fruiting body of Cordyceps sinensis |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Inflatin B (CHEBI:69271) has role metabolite (CHEBI:25212) |
| Inflatin B (CHEBI:69271) is a oxa-steroid (CHEBI:50917) |
| Synonym | Source |
|---|---|
| [(1S,2S,5R,7S,10R,11R,14S,16R,17R)-17-Hydroxy-7-(4-hydroxyphenyl)-2,10-dimethyl-6,8-dioxapentacyclo[14.3.1.0[1,14].0[2,11].0[5,10]]icos-17-yl]methyl acetate | ChEBI |
| Citations |
|---|