EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H38O5 |
| Net Charge | 0 |
| Average Mass | 442.596 |
| Monoisotopic Mass | 442.27192 |
| SMILES | [H][C@]12C[C@]3([H])CC[C@]4([H])[C@](C)(CC[C@@]5([H])O[C@@H](c6ccc(O)cc6)OC[C@@]45C)[C@@]3(CC[C@]1(O)CO)C2 |
| InChI | InChI=1S/C27H38O5/c1-24-16-31-23(17-3-6-20(29)7-4-17)32-22(24)9-10-25(2)21(24)8-5-18-13-19-14-26(18,25)11-12-27(19,30)15-28/h3-4,6-7,18-19,21-23,28-30H,5,8-16H2,1-2H3/t18-,19+,21-,22+,23-,24-,25-,26-,27-/m0/s1 |
| InChIKey | QXXWIRGFTIMWGL-WXAIGJAWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tolypocladium inflatum (ncbitaxon:29910) | - | PubMed (21812410) | Ethylacetate extract and fungus isolated from a soilsample on fruiting body of Cordyceps sinensis |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Inflatin A (CHEBI:69270) has role metabolite (CHEBI:25212) |
| Inflatin A (CHEBI:69270) is a oxa-steroid (CHEBI:50917) |
| Synonym | Source |
|---|---|
| (1S,2S,5R,7S,10R,11R,14S,16R,17R)-17-(Hydroxymethyl)-7-(4-hydroxyphenyl)-2,10-dimethyl-6,8-dioxapentacyclo[14.3.1.0[1,14].0[2,11].0[5,10]]icosan-17-ol | ChEBI |
| Citations |
|---|