EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15BrN2O5 |
| Net Charge | 0 |
| Average Mass | 419.231 |
| Monoisotopic Mass | 418.01643 |
| SMILES | N[C@@H](Cc1ccc(OC(=O)c2cnc3cc(Br)c(O)cc23)cc1)C(=O)O |
| InChI | InChI=1S/C18H15BrN2O5/c19-13-7-15-11(6-16(13)22)12(8-21-15)18(25)26-10-3-1-9(2-4-10)5-14(20)17(23)24/h1-4,6-8,14,21-22H,5,20H2,(H,23,24)/t14-/m0/s1 |
| InChIKey | PKFPVOPFIFUXPW-AWEZNQCLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Herdmania momus (ncbitaxon:7733) | - | PubMed (21770369) | Combined methanol and methylene chloride extract of frozened and chopped ascidians |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Herdmanine D (CHEBI:69269) has role metabolite (CHEBI:25212) |
| Herdmanine D (CHEBI:69269) is a indolyl carboxylic acid (CHEBI:46867) |
| Synonym | Source |
|---|---|
| (2S)-2-amino-3-[4-(6-bromo-5-hydroxy-1H-indole-3-carbonyl)oxyphenyl]propanoic acid | ChEBI |
| Citations |
|---|