EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N4O6 |
| Net Charge | 0 |
| Average Mass | 414.418 |
| Monoisotopic Mass | 414.15393 |
| SMILES | N=C(N)NCCC[C@@H](NC(=O)c1ccc(OC(=O)c2ccc(O)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C20H22N4O6/c21-20(22)23-11-1-2-16(18(27)28)24-17(26)12-5-9-15(10-6-12)30-19(29)13-3-7-14(25)8-4-13/h3-10,16,25H,1-2,11H2,(H,24,26)(H,27,28)(H4,21,22,23)/t16-/m1/s1 |
| InChIKey | AJMYUJYRCPUHHA-MRXNPFEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Herdmania momus (ncbitaxon:7733) | - | PubMed (21770369) | Combined methanol and methylene chloride extract of frozened and chopped ascidians |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Herdmanine C (CHEBI:69268) has role metabolite (CHEBI:25212) |
| Herdmanine C (CHEBI:69268) is a carbonyl compound (CHEBI:36586) |
| Synonyms | Source |
|---|---|
| (2R)-5-(diaminomethylideneamino)-2-[[4-(4-hydroxybenzoyl)oxybenzoyl]amino]pentanoic acid | ChEBI |
| N2-{4-[(4-Hydroxybenzoyl)oxy]benzoyl}-D-arginine | ChEBI |
| Citations |
|---|