EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O3 |
| Net Charge | 0 |
| Average Mass | 308.377 |
| Monoisotopic Mass | 308.14124 |
| SMILES | COc1cc(/C=C/C(C)=C/C(C)=C\c2ccccc2)oc(=O)c1 |
| InChI | InChI=1S/C20H20O3/c1-15(11-16(2)12-17-7-5-4-6-8-17)9-10-18-13-19(22-3)14-20(21)23-18/h4-14H,1-3H3/b10-9+,15-11+,16-12- |
| InChIKey | NLLRTVRDMOKHDF-CUEQUERMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | mycelium (BTO:0001436) | PubMed (21774474) | EtOAc extract of mycelium and broth, Endophytic fungus in inner tissue (fresh) of Avicennia marina Strain: MA 132 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nigerapyrone F (CHEBI:69263) has role Aspergillus metabolite (CHEBI:76956) |
| nigerapyrone F (CHEBI:69263) is a 2-pyranones (CHEBI:75885) |
| IUPAC Name |
|---|
| 6-[(1E,3E,5Z)-3,5-dimethyl-6-phenylhexa-1,3,5-trien-1-yl]-4-methoxy-2H-pyran-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21856164 | Reaxys |
| Citations |
|---|