EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O3 |
| Net Charge | 0 |
| Average Mass | 322.404 |
| Monoisotopic Mass | 322.15689 |
| SMILES | COc1cc(/C=C/C(C)=C/C(C)=C/c2ccccc2)oc(=O)c1C |
| InChI | InChI=1S/C21H22O3/c1-15(12-16(2)13-18-8-6-5-7-9-18)10-11-19-14-20(23-4)17(3)21(22)24-19/h5-14H,1-4H3/b11-10+,15-12+,16-13+ |
| InChIKey | YDNWVTUIFJBROE-CYXONCDGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | mycelium (BTO:0001436) | PubMed (21774474) | EtOAc extract of mycelium and broth, Endophytic fungus in inner tissue (fresh) of Avicennia marina Strain: MA 132 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asnipyrone A (CHEBI:69262) has role Aspergillus metabolite (CHEBI:76956) |
| asnipyrone A (CHEBI:69262) is a 2-pyranones (CHEBI:75885) |
| IUPAC Name |
|---|
| 6-[(1E,3E,5E)-3,5-dimethyl-6-phenylhexa-1,3,5-trien-1-yl]-4-methoxy-3-methyl-2H-pyran-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21856165 | Reaxys |
| Citations |
|---|