EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16O4 |
| Net Charge | 0 |
| Average Mass | 248.278 |
| Monoisotopic Mass | 248.10486 |
| SMILES | COc1cc(/C=C/C(C)=C/C(C)=O)oc(=O)c1C |
| InChI | InChI=1S/C14H16O4/c1-9(7-10(2)15)5-6-12-8-13(17-4)11(3)14(16)18-12/h5-8H,1-4H3/b6-5+,9-7+ |
| InChIKey | QNRKTRKCMAQCAK-SBIWHPGTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus niger (ncbitaxon:5061) | mycelium (BTO:0001436) | PubMed (21774474) | EtOAc extract of mycelium and broth, Endophytic fungus in inner tissue (fresh) of Avicennia marina Strain: MA 132 |
| Roles Classification |
|---|
| Biological Role: | Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nigerapyrone D (CHEBI:69259) has role Aspergillus metabolite (CHEBI:76956) |
| nigerapyrone D (CHEBI:69259) has role antineoplastic agent (CHEBI:35610) |
| nigerapyrone D (CHEBI:69259) is a 2-pyranones (CHEBI:75885) |
| nigerapyrone D (CHEBI:69259) is a methyl ketone (CHEBI:51867) |
| IUPAC Name |
|---|
| 4-methoxy-3-methyl-6-[(1E,3E)-3-methyl-5-oxohexa-1,3-dien-1-yl]-2H-pyran-2-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21856160 | Reaxys |
| Citations |
|---|