EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H74N10O12 |
| Net Charge | 0 |
| Average Mass | 995.189 |
| Monoisotopic Mass | 994.54877 |
| SMILES | [H][C@@]1(/C=C/C(C)=C/[C@H](C)[C@H](Cc2ccccc2)OC)NC(=O)[C@H](CCCNC(=N)N)NC(=O)[C@@H](C)[C@H](C(=O)O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](C)NC(=O)C(=C)N(C)C(=O)CC[C@H](C(=O)O)NC(=O)[C@H]1C |
| InChI | InChI=1S/C49H74N10O12/c1-26(2)23-37-46(66)58-40(48(69)70)30(6)42(62)55-35(17-14-22-52-49(50)51)45(65)54-34(19-18-27(3)24-28(4)38(71-10)25-33-15-12-11-13-16-33)29(5)41(61)56-36(47(67)68)20-21-39(60)59(9)32(8)44(64)53-31(7)43(63)57-37/h11-13,15-16,18-19,24,26,28-31,34-38,40H,8,14,17,20-23,25H2,1-7,9-10H3,(H,53,64)(H,54,65)(H,55,62)(H,56,61)(H,57,63)(H,58,66)(H,67,68)(H,69,70)(H4,50,51,52)/b19-18+,27-24+/t28-,29-,30-,31+,34-,35-,36+,37-,38-,40+/m0/s1 |
| InChIKey | ZYZCGGRZINLQBL-GWRQVWKTSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor Any EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor that interferes with the action of phosphoprotein phosphatase (EC 3.1.3.16). bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. hepatotoxic agent A role played by a chemical compound exhibiting itself through the ability to induce damage to the liver in animals. cyanotoxin Any toxin produced by cyanobacteria (blue-green algae). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| microcystin-LR (CHEBI:6925) has role bacterial metabolite (CHEBI:76969) |
| microcystin-LR (CHEBI:6925) has role EC 3.1.3.16 (phosphoprotein phosphatase) inhibitor (CHEBI:37153) |
| microcystin-LR (CHEBI:6925) has role environmental contaminant (CHEBI:78298) |
| microcystin-LR (CHEBI:6925) has role xenobiotic (CHEBI:35703) |
| microcystin-LR (CHEBI:6925) is a microcystin (CHEBI:48041) |
| IUPAC Name |
|---|
| cyclo[D-alanyl-L-leucyl-(3S)-3-methyl-D-β-aspartyl-L-arginyl-(2S,3S,4E,6E,8S,9S)-3-amino-4,5,6,7-tetradehydro-9-methoxy-2,6,8-trimethyl-10-phenyldecanoyl-D-γ-glutamyl-2,3-didehydro-N-methylalanyl] |
| Synonyms | Source |
|---|---|
| 1,7-anhydro[D-alanyl-L-leucyl-(3S)-3-methyl-D-β-aspartyl-L-arginyl-(2S,3S,4E,6E,8S,9S)-3-amino-4,5,6,7-tetradehydro-9-methoxy-2,6,8-trimethyl-10-phenyldecanoyl-D-γ-glutamyl-2,3-didehydro-N-methylalanine] | ChEBI |
| cyanoginosin LR | ChemIDplus |
| cyclo[2,3-didehydro-N-methylalanyl-D-alanyl-L-leucyl-erythro-3-methyl-D-β-aspartyl-L-arginyl-(2S,3S,4E,6E,8S,9S)-3-amino-4,5,6,7-tetradehydro-9-methoxy-2,6,8-trimethyl-10-phenyldecanoyl-D-γ-glutamyl] | ChEBI |
| Microcystis aeruginosa toxin | ChemIDplus |
| microcystin LR | ChEBI |
| Microcystin-LR | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05371 | KEGG COMPOUND |
| Microcystin-LR | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4779759 | Reaxys |
| CAS:101043-37-2 | ChemIDplus |
| CAS:101043-37-2 | KEGG COMPOUND |
| Citations |
|---|