EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19NO3 |
| Net Charge | 0 |
| Average Mass | 321.376 |
| Monoisotopic Mass | 321.13649 |
| SMILES | COc1cc(/C=C/C=C/C(C)=C/C=C/c2cccnc2)oc(=O)c1 |
| InChI | InChI=1S/C20H19NO3/c1-16(8-5-9-17-10-6-12-21-15-17)7-3-4-11-18-13-19(23-2)14-20(22)24-18/h3-15H,1-2H3/b7-3+,9-5+,11-4+,16-8+ |
| InChIKey | DRMNBCGDVZVONI-KSRFAKHSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces sp. (ncbitaxon:1931) | latex (BTO:0000710) | PubMed (21751787) | Previous component: resin; resin(XAD-7) and cell mass were extracted with acetone Strain: CNQ 301 |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyridinopyrone A (CHEBI:69242) has role metabolite (CHEBI:25212) |
| Pyridinopyrone A (CHEBI:69242) is a 2-pyranones (CHEBI:75885) |
| Synonym | Source |
|---|---|
| 4-methoxy-6-[(1E,3E,5E,7E)-5-methyl-8-pyridin-3-ylocta-1,3,5,7-tetraenyl]pyran-2-one | ChEBI |
| Citations |
|---|