EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O |
| Net Charge | 0 |
| Average Mass | 286.459 |
| Monoisotopic Mass | 286.22967 |
| SMILES | [H][C@@]12CCc3c(ccc(O)c3C(C)C)[C@@]1(C)CCCC2(C)C |
| InChI | InChI=1S/C20H30O/c1-13(2)18-14-7-10-17-19(3,4)11-6-12-20(17,5)15(14)8-9-16(18)21/h8-9,13,17,21H,6-7,10-12H2,1-5H3/t17-,20+/m0/s1 |
| InChIKey | ZRVDANDJSTYELM-FXAWDEMLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Biota orientalis (IPNI:261739-1) | |||
| twig (BTO:0001411) | PubMed (21793559) | Ethylacetate extract of frozened Cebaye(dried twigs and leaves of Biota orientalis) | |
| leaf (BTO:0000713) | PubMed (21793559) | Ethylacetate extract of frozened Cebaye(dried twigs and leaves of Biota orientalis) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| totarol (CHEBI:69241) has role metabolite (CHEBI:25212) |
| totarol (CHEBI:69241) is a diterpenoid (CHEBI:23849) |
| Synonym | Source |
|---|---|
| 14-Isopropylpodocarpa-8,11,13-trien-13-ol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:511-15-9 | ChemIDplus |
| Citations |
|---|