EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@@]12CCC3=C[C@@](C)(C=C)CC[C@]3([H])[C@@]1(C)CCC[C@@]2(C)C(=O)O |
| InChI | InChI=1S/C20H30O2/c1-5-18(2)12-9-15-14(13-18)7-8-16-19(15,3)10-6-11-20(16,4)17(21)22/h5,13,15-16H,1,6-12H2,2-4H3,(H,21,22)/t15-,16+,18-,19+,20+/m0/s1 |
| InChIKey | MHVJRKBZMUDEEV-KRFUXDQASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Austrocedrus chilensis (ncbitaxon:103964) | - | PubMed (24853713) | Isolated from the resin. |
| Biota orientalis (IPNI:261739-1) | |||
| leaf (BTO:0000713) | PubMed (21793559) | Ethyl acetate extract of Cebaye, Inseperable mixture of isopimaric acid and sandaracopimaric acid | |
| twig (BTO:0001411) | PubMed (21793559) | Ethyl acetate extract of Cebaye, Inseperable mixture of isopimaric acid and sandaracopimaric acid | |
| Cryptomeria japonica (ncbitaxon:3369) | - | PubMed (18674641) | |
| Juniperus chinensis (ncbitaxon:50182) | bark (BTO:0001301) | PubMed (18855216) | |
| Pinus densiflora (ncbitaxon:77912) | root (BTO:0001188) | PubMed (28674826) | |
| Pinus pumila (ncbitaxon:71649) | - | PubMed (23418167) | Isolated from hexane extracts of needles. |
| Platycladus orientalis (ncbitaxon:58046) | cone (BTO:0000280) | PubMed (23627129) | |
| Taxodium distichum (ncbitaxon:28982) | cone (BTO:0000280) | PubMed (19475449) | |
| Wollemia nobilis (ncbitaxon:56998) | cone (BTO:0000280) | PubMed (28296157) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sandaracopimaric acid (CHEBI:69240) has role plant metabolite (CHEBI:76924) |
| sandaracopimaric acid (CHEBI:69240) is a monocarboxylic acid (CHEBI:25384) |
| sandaracopimaric acid (CHEBI:69240) is a pimarane diterpenoid (CHEBI:49192) |
| sandaracopimaric acid (CHEBI:69240) is a tricyclic diterpenoid (CHEBI:79084) |
| IUPAC Name |
|---|
| 13α-pimara-8(14),15-dien-18-oic acid |
| Synonyms | Source |
|---|---|
| 13β-methyl-13-vinyl-podocarp-8(14)-en-15-oic acid | ChemIDplus |
| cryptopimaric acid | ChEBI |
| (−)-sandaracopimaric acid | KNApSAcK |
| Citations |
|---|