EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O2 |
| Net Charge | 0 |
| Average Mass | 302.458 |
| Monoisotopic Mass | 302.22458 |
| SMILES | [H][C@@]12CCC3=C[C@@](C)(C=C)CC[C@]3([H])[C@@]1(C)CC[C@H](O)[C@@]2(C)C=O |
| InChI | InChI=1S/C20H30O2/c1-5-18(2)10-8-15-14(12-18)6-7-16-19(15,3)11-9-17(22)20(16,4)13-21/h5,12-13,15-17,22H,1,6-11H2,2-4H3/t15-,16+,17-,18-,19+,20-/m0/s1 |
| InChIKey | YDVNGHMXZNRYKV-APNJTCTJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Biota orientalis (IPNI:261739-1) | |||
| leaf (BTO:0000713) | PubMed (21793559) | Ethylacetate extract of frozened Cebaye(dried twigs and leaves of Biota orientalis) | |
| twig (BTO:0001411) | PubMed (21793559) | Ethylacetate extract of frozened Cebaye(dried twigs and leaves of Biota orientalis) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sandaracopimaradienolal (CHEBI:69239) has role metabolite (CHEBI:25212) |
| sandaracopimaradienolal (CHEBI:69239) is a diterpenoid (CHEBI:23849) |
| Citations |
|---|