EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O4 |
| Net Charge | 0 |
| Average Mass | 346.467 |
| Monoisotopic Mass | 346.21441 |
| SMILES | [H][C@@]12CCC(=C)[C@H](CCC3=CCOC3=O)[C@@]1(C)CCC[C@]2(C)C(=O)OC |
| InChI | InChI=1S/C21H30O4/c1-14-6-9-17-20(2,11-5-12-21(17,3)19(23)24-4)16(14)8-7-15-10-13-25-18(15)22/h10,16-17H,1,5-9,11-13H2,2-4H3/t16-,17+,20+,21-/m0/s1 |
| InChIKey | WTKBZJAWPZXKJU-NLEAXPPASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Biota orientalis (IPNI:261739-1) | |||
| twig (BTO:0001411) | PubMed (21793559) | Ethylacetate extract of frozened Cebaye(dried twigs and leaves of Biota orientalis) | |
| leaf (BTO:0000713) | PubMed (21793559) | Ethylacetate extract of frozened Cebaye(dried twigs and leaves of Biota orientalis) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pinusolide (CHEBI:69237) has role metabolite (CHEBI:25212) |
| pinusolide (CHEBI:69237) is a diterpene lactone (CHEBI:49193) |
| Synonyms | Source |
|---|---|
| 1-Naphthalenecarboxylic acid, 5-(2-(2,5-dihydro-2-oxo-3-furanyl)ethyl)decahydro-1,4a-dimethyl-6-methylene-, methylester, (1S-(1alpha,4aalpha,5alpha,8abeta))- | ChEBI |
| Indol-3-carbinol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:31685-80-0 | ChemIDplus |
| Citations |
|---|