EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:69236 - falcarindiol
| Formula | C17H24O2 |
| Net Charge | 0 |
| Average Mass | 260.377 |
| Monoisotopic Mass | 260.17763 |
| SMILES | C=C[C@H](O)C#CC#C[C@@H](O)/C=C\CCCCCCC |
| InChI | InChI=1S/C17H24O2/c1-3-5-6-7-8-9-10-14-17(19)15-12-11-13-16(18)4-2/h4,10,14,16-19H,2-3,5-9H2,1H3/b14-10-/t16-,17-/m0/s1 |
| InChIKey | QWCNQXNAFCBLLV-RCQSYPNMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Apium graveolens (ncbitaxon:4045) | - | PubMed (21800857) | |
| Daucus carota (ncbitaxon:4039) | |||
| exocarp (BTO:0000733) | PubMed (21800857) | Compound is in basal part of root phloem,in peel and in greening and dark spots of root tissue | |
| root (BTO:0001188) | PubMed (21800857) | Compound is in basal part of root phloem,in peel and in greening and dark spots of root tissue | |
| Daucus carota subsp. carota (ncbitaxon:79196) | - | PubMed (21800857) | |
| Daucus carota subsp. gummifer (ncbitaxon:79197) | root (BTO:0001188) | PubMed (21800857) | |
| Daucus carota subsp. maritimus (ncbitaxon:126355) | |||
| periderm (BTO:0003377) | PubMed (21800857) | ||
| phloem (BTO:0001058) | PubMed (21800857) | ||
| root (BTO:0001188) | PubMed (21800857) | ||
| Daucus carota subsp. maximus (ncbitaxon:79199) | root (BTO:0001188) | PubMed (21800857) | |
| Daucus carota subsp. sativus (ncbitaxon:79200) | - | PubMed (21800857) | |
| Pastinaca sativa (ncbitaxon:4041) | - | PubMed (21800857) | |
| Petroselinum crispum (ncbitaxon:4043) | - | PubMed (21800857) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| falcarindiol (CHEBI:69236) has role metabolite (CHEBI:25212) |
| falcarindiol (CHEBI:69236) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| (3S,8S,9Z)-heptadeca-1,9-dien-4,6-diyne-3,8-diol | ChEBI |
| Falcalindiol | ChEBI |
| Falcarindiol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001283 | KNApSAcK |
| C08449 | KEGG COMPOUND |
| HMDB0033941 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:55297-87-5 | KEGG COMPOUND |
| CAS:55297-87-5 | ChemIDplus |
| Citations |
|---|