EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2O2 |
| Net Charge | 0 |
| Average Mass | 228.251 |
| Monoisotopic Mass | 228.08988 |
| SMILES | COc1cc(/C=N/O)nc(-c2ccccc2)c1 |
| InChI | InChI=1S/C13H12N2O2/c1-17-12-7-11(9-14-16)15-13(8-12)10-5-3-2-4-6-10/h2-9,16H,1H3/b14-9+ |
| InChIKey | PXFUULIZLQXHKZ-NTEUORMPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinoalloteichus cyanogriseus (ncbitaxon:65497) | - | PubMed (21770434) | Ethyl acetate extract of fermentation broth Strain: WH1 2216-6 |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caerulomycin K (CHEBI:69230) has role antineoplastic agent (CHEBI:35610) |
| caerulomycin K (CHEBI:69230) has role bacterial metabolite (CHEBI:76969) |
| caerulomycin K (CHEBI:69230) has role marine metabolite (CHEBI:76507) |
| caerulomycin K (CHEBI:69230) is a aldoxime (CHEBI:22307) |
| caerulomycin K (CHEBI:69230) is a aromatic ether (CHEBI:35618) |
| caerulomycin K (CHEBI:69230) is a pyridine alkaloid (CHEBI:26416) |
| IUPAC Name |
|---|
| (E)-N-hydroxy-1-(4-methoxy-6-phenylpyridin-2-yl)methanimine |
| Synonym | Source |
|---|---|
| (E)-4-methoxy-2-phenylpyridine-6-carbaldehyde oxime | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 26617633 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21856152 | Reaxys |
| Citations |
|---|