EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H14N2O3 |
| Net Charge | 0 |
| Average Mass | 246.266 |
| Monoisotopic Mass | 246.10044 |
| SMILES | COc1cc(CO)nc(-c2ccccn2)c1OC |
| InChI | InChI=1S/C13H14N2O3/c1-17-11-7-9(8-16)15-12(13(11)18-2)10-5-3-4-6-14-10/h3-7,16H,8H2,1-2H3 |
| InChIKey | NOWSJBQEOYCSBC-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinoalloteichus cyanogriseus (ncbitaxon:65497) | - | PubMed (21770434) | Ethyl acetate extract of fermentation broth Strain: WH1 2216-6 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| caerulomycin G (CHEBI:69226) has parent hydride 2,2'-bipyridine (CHEBI:30351) |
| caerulomycin G (CHEBI:69226) has role antineoplastic agent (CHEBI:35610) |
| caerulomycin G (CHEBI:69226) has role bacterial metabolite (CHEBI:76969) |
| caerulomycin G (CHEBI:69226) has role marine metabolite (CHEBI:76507) |
| caerulomycin G (CHEBI:69226) is a aromatic ether (CHEBI:35618) |
| caerulomycin G (CHEBI:69226) is a bipyridines (CHEBI:50511) |
| caerulomycin G (CHEBI:69226) is a monohydroxypyridine (CHEBI:38182) |
| caerulomycin G (CHEBI:69226) is a pyridine alkaloid (CHEBI:26416) |
| IUPAC Name |
|---|
| (3,4-dimethoxy-2,2'-bipyridin-6-yl)methanol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21856154 | Reaxys |
| Citations |
|---|