EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O3 |
| Net Charge | 0 |
| Average Mass | 454.695 |
| Monoisotopic Mass | 454.34470 |
| SMILES | [H][C@]12C=C[C@]34OC(=O)[C@@]5(CCC(C)(C)C[C@]53[H])CC[C@@]4(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H46O3/c1-24(2)14-16-29-17-15-28(7)27(6)12-8-19-25(3,4)22(31)10-11-26(19,5)20(27)9-13-30(28,21(29)18-24)33-23(29)32/h9,13,19-22,31H,8,10-12,14-18H2,1-7H3/t19-,20+,21+,22+,26-,27+,28-,29-,30-/m0/s1 |
| InChIKey | VQUPEZXRIUOIJE-XDPQSBAJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fatsia polycarpa (ncbitaxon:230586) | |||
| twig (BTO:0001411) | PubMed (21766884) | Methylene dichloride soluble fraction of MeOH extract of air-dried and powdered leaves and twigs | |
| leaf (BTO:0000713) | PubMed (21766884) | Methylene dichloride soluble fraction of MeOH extract of air-dried and powdered leaves and twigs |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3α-hydroxyolean-11-en-28,13β-olide (CHEBI:69224) has parent hydride oleanane (CHEBI:36481) |
| 3α-hydroxyolean-11-en-28,13β-olide (CHEBI:69224) has role metabolite (CHEBI:25212) |
| 3α-hydroxyolean-11-en-28,13β-olide (CHEBI:69224) has role plant metabolite (CHEBI:76924) |
| 3α-hydroxyolean-11-en-28,13β-olide (CHEBI:69224) is a hexacyclic triterpenoid (CHEBI:70994) |
| 3α-hydroxyolean-11-en-28,13β-olide (CHEBI:69224) is a secondary alcohol (CHEBI:35681) |
| 3α-hydroxyolean-11-en-28,13β-olide (CHEBI:69224) is a terpene lactone (CHEBI:37668) |
| IUPAC Name |
|---|
| (3α)-3-hydroxy-13,28-epoxyolean-11-en-28-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8739334 | Reaxys |
| Citations |
|---|