EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O3 |
| Net Charge | 0 |
| Average Mass | 454.695 |
| Monoisotopic Mass | 454.34470 |
| SMILES | [H][C@]12C=CC3=C4CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H46O3/c1-25(2)14-16-30(24(32)33)17-15-28(6)19(20(30)18-25)8-9-22-27(5)12-11-23(31)26(3,4)21(27)10-13-29(22,28)7/h8-9,21-23,31H,10-18H2,1-7H3,(H,32,33)/t21-,22+,23+,27-,28+,29+,30-/m0/s1 |
| InChIKey | XMOMYSSKYVFTKO-LNVXMQETSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fatsia polycarpa (ncbitaxon:230586) | |||
| leaf (BTO:0000713) | PubMed (21766884) | CH2Cl2 soluble fraction of Methanolic extract of air-dried, powdered leaves and twigs | |
| twig (BTO:0001411) | PubMed (21766884) | CH2Cl2 soluble fraction of Methanolic extract of air-dried, powdered leaves and twigs |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3α-hydroxyolean-11,13(18)-dien-28-oic acid (CHEBI:69223) has parent hydride oleanane (CHEBI:36481) |
| 3α-hydroxyolean-11,13(18)-dien-28-oic acid (CHEBI:69223) has role metabolite (CHEBI:25212) |
| 3α-hydroxyolean-11,13(18)-dien-28-oic acid (CHEBI:69223) has role plant metabolite (CHEBI:76924) |
| 3α-hydroxyolean-11,13(18)-dien-28-oic acid (CHEBI:69223) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| 3α-hydroxyolean-11,13(18)-dien-28-oic acid (CHEBI:69223) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| (3α)-3-hydroxyoleana-11,13(18)-dien-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8739750 | Reaxys |
| Citations |
|---|