EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H46O4 |
| Net Charge | 0 |
| Average Mass | 470.694 |
| Monoisotopic Mass | 470.33961 |
| SMILES | [H][C@]12C=C[C@]34OC(=O)[C@@]5(CCC(C)(C)C[C@]53[H])CC[C@@]4(C)[C@]1(C)CC[C@]1([H])[C@]2(C)CC[C@@H](O)[C@@]1(C)CO |
| InChI | InChI=1S/C30H46O4/c1-24(2)13-15-29-16-14-28(6)27(5)11-7-19-25(3,10-9-22(32)26(19,4)18-31)20(27)8-12-30(28,21(29)17-24)34-23(29)33/h8,12,19-22,31-32H,7,9-11,13-18H2,1-6H3/t19-,20-,21-,22-,25+,26+,27-,28+,29+,30+/m1/s1 |
| InChIKey | CEBUWXCYJVYZSN-XEMCBIIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fatsia polycarpa (ncbitaxon:230586) | |||
| leaf (BTO:0000713) | PubMed (21766884) | Methylene dichloride soluble fraction of MeOH extract of air-dried and powdered leaves and twigs | |
| twig (BTO:0001411) | PubMed (21766884) | Methylene dichloride soluble fraction of MeOH extract of air-dried and powdered leaves and twigs |
| Roles Classification |
|---|
| Biological Roles: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fatsicarpain G (CHEBI:69222) has parent hydride oleanane (CHEBI:36481) |
| fatsicarpain G (CHEBI:69222) has role anti-HBV agent (CHEBI:64951) |
| fatsicarpain G (CHEBI:69222) has role metabolite (CHEBI:25212) |
| fatsicarpain G (CHEBI:69222) has role plant metabolite (CHEBI:76924) |
| fatsicarpain G (CHEBI:69222) is a diol (CHEBI:23824) |
| fatsicarpain G (CHEBI:69222) is a hexacyclic triterpenoid (CHEBI:70994) |
| fatsicarpain G (CHEBI:69222) is a terpene lactone (CHEBI:37668) |
| IUPAC Name |
|---|
| rel-(3α)-3,23-dihydroxy-13,28-epoxyolean-11-en-28-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21876586 | Reaxys |
| Citations |
|---|