EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O4 |
| Net Charge | 0 |
| Average Mass | 472.710 |
| Monoisotopic Mass | 472.35526 |
| SMILES | [H][C@]12[C@H](O)C[C@]3([H])C4=CC(C)(C)CC[C@]4(C(=O)O)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@H](O)CC[C@]21C |
| InChI | InChI=1S/C30H48O4/c1-25(2)12-14-30(24(33)34)15-13-28(6)18(19(30)17-25)16-20(31)23-27(5)10-9-22(32)26(3,4)21(27)8-11-29(23,28)7/h17-18,20-23,31-32H,8-16H2,1-7H3,(H,33,34)/t18-,20-,21+,22-,23-,27+,28-,29-,30+/m1/s1 |
| InChIKey | TZKAUVVTNXKRNY-GKNIEUGRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fatsia polycarpa (ncbitaxon:230586) | |||
| twig (BTO:0001411) | PubMed (21766884) | Methylene dichloride soluble fraction of MeOH extract of air-dried and powdered leaves and twigs | |
| leaf (BTO:0000713) | PubMed (21766884) | Methylene dichloride soluble fraction of MeOH extract of air-dried and powdered leaves and twigs |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fatsicarpain E (CHEBI:69220) has parent hydride oleanane (CHEBI:36481) |
| fatsicarpain E (CHEBI:69220) has role plant metabolite (CHEBI:76924) |
| fatsicarpain E (CHEBI:69220) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| fatsicarpain E (CHEBI:69220) is a pentacyclic triterpenoid (CHEBI:25872) |
| IUPAC Name |
|---|
| rel-(3R,11R)-3,11-dihydroxyolean-18-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21876588 | Reaxys |
| Citations |
|---|