EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H49NO8 |
| Net Charge | 0 |
| Average Mass | 539.710 |
| Monoisotopic Mass | 539.34582 |
| SMILES | CCCCCCC/C=C(\C)[C@@H](O)[C@@H](C)C(=O)N1CCC[C@H]1C(=O)O[C@@H](C(=O)O[C@@H](C)C(=O)OC)[C@@H](C)CC |
| InChI | InChI=1S/C29H49NO8/c1-8-10-11-12-13-14-16-20(4)24(31)21(5)26(32)30-18-15-17-23(30)28(34)38-25(19(3)9-2)29(35)37-22(6)27(33)36-7/h16,19,21-25,31H,8-15,17-18H2,1-7H3/b20-16+/t19-,21+,22-,23-,24+,25+/m0/s1 |
| InChIKey | RYWKXTITOBZASH-DZOJKPGOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oscillatoria margaritifera NAC8-55 (ncbitaxon:748040) | - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) |
| Oscillatoria margaritifera (ncbitaxon:748017) | |||
| - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) Strain: NAC8 46 | |
| - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) Strain: NAC8 45 | |
| Oscillatoria margaritifera NAC8-54 (ncbitaxon:748039) | - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl tumonoate B (CHEBI:69214) has role metabolite (CHEBI:25212) |
| methyl tumonoate B (CHEBI:69214) is a depsipeptide (CHEBI:23643) |
| Synonym | Source |
|---|---|
| (2R,3S)-1-{[(2S)-1-Methoxy-1-oxo-2-propanyl]oxy}-3-methyl-1-oxo-2-pentanyl 1-[(2R,3S,4E)-3-hydroxy-2,4-dimethyl-4-dodecenoyl]-L-prolinate | ChEBI |
| Citations |
|---|