EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H37NO5 |
| Net Charge | 0 |
| Average Mass | 383.529 |
| Monoisotopic Mass | 383.26717 |
| SMILES | CCCCCCCCC(C)[C@H](OC(C)=O)[C@H](C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C21H37NO5/c1-5-6-7-8-9-10-12-15(2)19(27-17(4)23)16(3)20(24)22-14-11-13-18(22)21(25)26/h15-16,18-19H,5-14H2,1-4H3,(H,25,26)/t15?,16-,18-,19-/m0/s1 |
| InChIKey | PFYSYVJVRRSPAP-PVRLSMEHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oscillatoria margaritifera NAC8-55 (ncbitaxon:748040) | - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) |
| Oscillatoria margaritifera (ncbitaxon:748017) | |||
| - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) Strain: NAC8 46 | |
| - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) Strain: NAC8 45 | |
| Oscillatoria margaritifera NAC8-54 (ncbitaxon:748039) | - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tumonoic acid F (CHEBI:69211) has role metabolite (CHEBI:25212) |
| tumonoic acid F (CHEBI:69211) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| (2S)-1-[(2S,3S)-3-acetyloxy-2,4-dimethyldodecanoyl]pyrrolidine-2-carboxylic acid | ChEBI |
| Citations |
|---|