EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H31NO4 |
| Net Charge | 0 |
| Average Mass | 325.449 |
| Monoisotopic Mass | 325.22531 |
| SMILES | CCCCC(C)/C=C(\C)[C@H](O)[C@H](C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C18H31NO4/c1-5-6-8-12(2)11-13(3)16(20)14(4)17(21)19-10-7-9-15(19)18(22)23/h11-12,14-16,20H,5-10H2,1-4H3,(H,22,23)/b13-11+/t12?,14-,15-,16-/m0/s1 |
| InChIKey | UUFOMZNZQYHUJH-UKUODDPASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oscillatoria margaritifera (ncbitaxon:748017) | |||
| - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) Strain: NAC8 45 | |
| - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) Strain: NAC8 46 | |
| Oscillatoria margaritifera NAC8-54 (ncbitaxon:748039) | - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) |
| Oscillatoria margaritifera NAC8-55 (ncbitaxon:748040) | - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tumonoic acid E (CHEBI:69210) has role metabolite (CHEBI:25212) |
| tumonoic acid E (CHEBI:69210) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| 1-[(2S,3R,4E)-3-Hydroxy-2,4,6-trimethyl-4-decenoyl]-L-proline | ChEBI |
| Citations |
|---|