EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H33NO4 |
| Net Charge | 0 |
| Average Mass | 339.476 |
| Monoisotopic Mass | 339.24096 |
| SMILES | CCCCCCC/C=C(\C)[C@@H](O)[C@@H](C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C19H33NO4/c1-4-5-6-7-8-9-11-14(2)17(21)15(3)18(22)20-13-10-12-16(20)19(23)24/h11,15-17,21H,4-10,12-13H2,1-3H3,(H,23,24)/b14-11+/t15-,16+,17-/m1/s1 |
| InChIKey | JFFANXXIOVCBBG-PYIPWEHNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Oscillatoria margaritifera (ncbitaxon:748017) | |||
| - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) Strain: NAC8 45 | |
| - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) Strain: NAC8 46 | |
| Oscillatoria margaritifera NAC8-55 (ncbitaxon:748040) | - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) |
| Oscillatoria margaritifera NAC8-54 (ncbitaxon:748039) | - | PubMed (21751786) | Extracted with CHCl2/MeOH (2:1) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tumonoic acid A (CHEBI:69207) has role metabolite (CHEBI:25212) |
| tumonoic acid A (CHEBI:69207) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| 1-[(2R,3S,4E)-3-Hydroxy-2,4-dimethyl-4-dodecenoyl]-L-proline | ChEBI |
| Citations |
|---|