EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H52O2 |
| Net Charge | 0 |
| Average Mass | 444.744 |
| Monoisotopic Mass | 444.39673 |
| SMILES | [H][C@@]12CC[C@@](C)(O)[C@H](CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)[C@@]1(C)CC[C@H](O)C2(C)C |
| InChI | InChI=1S/C30H52O2/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-26-29(7)20-19-27(31)28(5,6)25(29)18-21-30(26,8)32/h12,14,16,25-27,31-32H,9-11,13,15,17-21H2,1-8H3/b23-14+,24-16+/t25-,26+,27-,29-,30+/m0/s1 |
| InChIKey | QGERZRKJXVVRQA-NJACTVBXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Commiphora mukul (IPNI:127738-1) | latex (BTO:0000710) | PubMed (21800858) | Previous component: resin; Guggulu(gum resin) of Commiphora mukul |
| Pistacia lentiscus (ncbitaxon:371726) | latex (BTO:0000710) | PubMed (21800858) | Previous component: resin; Oleogum resin of Pistacia lentiscus |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (8R)-3β,8-dihydroxypolypoda-13E,17E,21-triene (CHEBI:69206) has role plant metabolite (CHEBI:76924) |
| (8R)-3β,8-dihydroxypolypoda-13E,17E,21-triene (CHEBI:69206) is a carbobicyclic compound (CHEBI:36785) |
| (8R)-3β,8-dihydroxypolypoda-13E,17E,21-triene (CHEBI:69206) is a diol (CHEBI:23824) |
| (8R)-3β,8-dihydroxypolypoda-13E,17E,21-triene (CHEBI:69206) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| (2S,4aS,5R,6R,8aR)-1,1,4a,6-tetramethyl-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trien-1-yl]decahydronaphthalene-2,6-diol |
| Synonym | Source |
|---|---|
| (2S,6R)-1,1,4a,6-tetramethyl-5-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]decalin-2,6-diol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6232172 | Reaxys |
| Citations |
|---|