EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H53N5O8 |
| Net Charge | 0 |
| Average Mass | 599.770 |
| Monoisotopic Mass | 599.38941 |
| SMILES | CCCCCCCCCCC[C@@H](O)CC(=O)N[C@@H](CC(N)=O)C(=O)NC(C(=O)NC(C=O)CC(C)C)[C@H](O)CC(N)=O |
| InChI | InChI=1S/C29H53N5O8/c1-4-5-6-7-8-9-10-11-12-13-21(36)15-26(40)33-22(16-24(30)38)28(41)34-27(23(37)17-25(31)39)29(42)32-20(18-35)14-19(2)3/h18-23,27,36-37H,4-17H2,1-3H3,(H2,30,38)(H2,31,39)(H,32,42)(H,33,40)(H,34,41)/t20?,21-,22+,23-,27?/m1/s1 |
| InChIKey | GTUJBZDZEFIEQV-MRCGXDCXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Metulocladosporiella (ncbitaxon:330783) | - | PubMed (21761939) | Methylethyl ketone extract of fermentation broth of undescribed species of Metulocladosporiella Strain: F 192 783 |
| Roles Classification |
|---|
| Biological Roles: | antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fellutamide D (CHEBI:69205) has role antifungal agent (CHEBI:35718) |
| fellutamide D (CHEBI:69205) has role fungal metabolite (CHEBI:76946) |
| fellutamide D (CHEBI:69205) is a aldehyde (CHEBI:17478) |
| fellutamide D (CHEBI:69205) is a dicarboxylic acid diamide (CHEBI:35779) |
| fellutamide D (CHEBI:69205) is a diol (CHEBI:23824) |
| fellutamide D (CHEBI:69205) is a secondary alcohol (CHEBI:35681) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:21871415 | Reaxys |
| Citations |
|---|