EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O5 |
| Net Charge | 0 |
| Average Mass | 272.256 |
| Monoisotopic Mass | 272.06847 |
| SMILES | O=C1COc2cc(O)ccc2-c2cc(O)c(O)cc2C1 |
| InChI | InChI=1S/C15H12O5/c16-9-1-2-11-12-6-14(19)13(18)4-8(12)3-10(17)7-20-15(11)5-9/h1-2,4-6,16,18-19H,3,7H2 |
| InChIKey | MUKYVRVYBBYJSI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caesalpinia sappan (ncbitaxon:483143) | heartwood (PO:0004512) | PubMed (21800859) | Methanolic extract of dried heart wood of C.sappan(Caesalpinia001) |
| Roles Classification |
|---|
| ChEBI Ontology |
|---|
| Synonyms | Source |
|---|---|
| 6H-Dibenz(b,d)oxocin-7(8H)-one, 3,10,11-trihydroxy- | ChEBI |
| Sappanol B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:102036-28-2 | ChemIDplus |
| Citations |
|---|