EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38FN3O3 |
| Net Charge | 0 |
| Average Mass | 495.639 |
| Monoisotopic Mass | 495.28972 |
| SMILES | COCC(=O)O[C@]1(CCN(C)CCCc2nc3ccccc3n2)CCc2cc(F)ccc2[C@@H]1C(C)C |
| InChI | InChI=1S/C29H38FN3O3/c1-20(2)28-23-12-11-22(30)18-21(23)13-14-29(28,36-27(34)19-35-4)15-17-33(3)16-7-10-26-31-24-8-5-6-9-25(24)32-26/h5-6,8-9,11-12,18,20,28H,7,10,13-17,19H2,1-4H3,(H,31,32)/t28-,29-/m0/s1 |
| InChIKey | HBNPJJILLOYFJU-VMPREFPWSA-N |
| Roles Classification |
|---|
| Biological Role: | T-type calcium channel blocker Any agent that interferes with the activity of T-type calcium channels. |
| Applications: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mibefradil (CHEBI:6920) has role antineoplastic agent (CHEBI:35610) |
| Mibefradil (CHEBI:6920) has role cardiovascular drug (CHEBI:35554) |
| Mibefradil (CHEBI:6920) has role T-type calcium channel blocker (CHEBI:194338) |
| Mibefradil (CHEBI:6920) is a tetralins (CHEBI:36786) |
| Synonyms | Source |
|---|---|
| Mibefradil | KEGG COMPOUND |
| mibefradil dihydrochloride | DrugCentral |
| posicor | DrugCentral |
| Ro 40-5967 | DrugCentral |
| Brand Names | Source |
|---|---|
| Posicor 100 | ChEMBL |
| Posicor 50 | ChEMBL |
| Citations |
|---|