EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H16O5 |
| Net Charge | 0 |
| Average Mass | 288.299 |
| Monoisotopic Mass | 288.09977 |
| SMILES | Oc1ccc(C[C@@]2(O)COc3cc(O)ccc3[C@@H]2O)cc1 |
| InChI | InChI=1S/C16H16O5/c17-11-3-1-10(2-4-11)8-16(20)9-21-14-7-12(18)5-6-13(14)15(16)19/h1-7,15,17-20H,8-9H2/t15-,16+/m0/s1 |
| InChIKey | IYAYKNOVHBOSPH-JKSUJKDBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caesalpinia sappan (ncbitaxon:483143) | heartwood (PO:0004512) | PubMed (21800859) | Methanolic extract of dried heart wood of C.sappan(Caesalpinia001) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-deoxysappanol (CHEBI:69197) has role plant metabolite (CHEBI:76924) |
| 3'-deoxysappanol (CHEBI:69197) is a homoisoflavonoid (CHEBI:86008) |
| 3'-deoxysappanol (CHEBI:69197) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| (3R,4S)-3-[(4-hydroxyphenyl)methyl]-3,4-dihydro-2H-1-benzopyran-3,4,7-triol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6066396 | Reaxys |
| Citations |
|---|