EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8O4 |
| Net Charge | 0 |
| Average Mass | 180.159 |
| Monoisotopic Mass | 180.04226 |
| SMILES | O=C1c2ccc(O)cc2OC[C@@H]1O |
| InChI | InChI=1S/C9H8O4/c10-5-1-2-6-8(3-5)13-4-7(11)9(6)12/h1-3,7,10-11H,4H2/t7-/m0/s1 |
| InChIKey | GLPDBGACWOZVNL-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caesalpinia sappan (ncbitaxon:483143) | heartwood (PO:0004512) | PubMed (21800859) | Methanolic extract of dried heart wood C.sappan(Caesalpinia001) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-3,7-dihydroxychroman-4-one (CHEBI:69195) has role metabolite (CHEBI:25212) |
| (S)-3,7-dihydroxychroman-4-one (CHEBI:69195) is a chromones (CHEBI:23238) |
| Citations |
|---|